2-(4-chlorophenoxy)-1-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]ethan-1-one
Chemical Structure Depiction of
2-(4-chlorophenoxy)-1-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]ethan-1-one
2-(4-chlorophenoxy)-1-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]ethan-1-one
Compound characteristics
| Compound ID: | 4092-0021 |
| Compound Name: | 2-(4-chlorophenoxy)-1-[4-(3,4,5-trimethoxybenzoyl)piperazin-1-yl]ethan-1-one |
| Molecular Weight: | 448.9 |
| Molecular Formula: | C22 H25 Cl N2 O6 |
| Smiles: | COc1cc(cc(c1OC)OC)C(N1CCN(CC1)C(COc1ccc(cc1)[Cl])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.9842 |
| logD: | 1.9842 |
| logSw: | -2.9944 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 63.292 |
| InChI Key: | QIXDXOOPXMVAKN-UHFFFAOYSA-N |