[4-(benzenesulfonyl)piperazin-1-yl](3,4,5-trimethoxyphenyl)methanone
Chemical Structure Depiction of
[4-(benzenesulfonyl)piperazin-1-yl](3,4,5-trimethoxyphenyl)methanone
[4-(benzenesulfonyl)piperazin-1-yl](3,4,5-trimethoxyphenyl)methanone
Compound characteristics
| Compound ID: | 4092-0151 |
| Compound Name: | [4-(benzenesulfonyl)piperazin-1-yl](3,4,5-trimethoxyphenyl)methanone |
| Molecular Weight: | 420.48 |
| Molecular Formula: | C20 H24 N2 O6 S |
| Smiles: | COc1cc(cc(c1OC)OC)C(N1CCN(CC1)S(c1ccccc1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.6947 |
| logD: | 1.6947 |
| logSw: | -2.579 |
| Hydrogen bond acceptors count: | 10 |
| Polar surface area: | 71.383 |
| InChI Key: | GGBIZFAFMJRBHP-UHFFFAOYSA-N |