1-(1-benzylpiperidin-4-yl)-4-[(5-bromo-2-methoxyphenyl)methyl]piperazine--oxalic acid (1/1)
Chemical Structure Depiction of
1-(1-benzylpiperidin-4-yl)-4-[(5-bromo-2-methoxyphenyl)methyl]piperazine--oxalic acid (1/1)
1-(1-benzylpiperidin-4-yl)-4-[(5-bromo-2-methoxyphenyl)methyl]piperazine--oxalic acid (1/1)
Compound characteristics
| Compound ID: | 4092-0754 |
| Compound Name: | 1-(1-benzylpiperidin-4-yl)-4-[(5-bromo-2-methoxyphenyl)methyl]piperazine--oxalic acid (1/1) |
| Molecular Weight: | 548.48 |
| Molecular Formula: | C24 H32 Br N3 O |
| Salt: | HOOCCOOH |
| Smiles: | COc1ccc(cc1CN1CCN(CC1)C1CCN(CC1)Cc1ccccc1)[Br] |
| Stereo: | ACHIRAL |
| logP: | 4.2613 |
| logD: | 3.5508 |
| logSw: | -4.2333 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 18.2353 |
| InChI Key: | OSCKNXLWMRDEED-UHFFFAOYSA-N |