1-[(2,4-dimethoxyphenyl)methyl]-4-[(3-ethoxy-4-methoxyphenyl)methyl]piperazine--oxalic acid (1/1)
Chemical Structure Depiction of
1-[(2,4-dimethoxyphenyl)methyl]-4-[(3-ethoxy-4-methoxyphenyl)methyl]piperazine--oxalic acid (1/1)
1-[(2,4-dimethoxyphenyl)methyl]-4-[(3-ethoxy-4-methoxyphenyl)methyl]piperazine--oxalic acid (1/1)
Compound characteristics
| Compound ID: | 4092-0845 |
| Compound Name: | 1-[(2,4-dimethoxyphenyl)methyl]-4-[(3-ethoxy-4-methoxyphenyl)methyl]piperazine--oxalic acid (1/1) |
| Molecular Weight: | 490.55 |
| Molecular Formula: | C23 H32 N2 O4 |
| Salt: | HOOCCOOH |
| Smiles: | CCOc1cc(CN2CCN(CC2)Cc2ccc(cc2OC)OC)ccc1OC |
| Stereo: | ACHIRAL |
| logP: | 2.7663 |
| logD: | 1.795 |
| logSw: | -2.847 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 37.526 |
| InChI Key: | AXVZKFUSZXSFBO-UHFFFAOYSA-N |