ethyl 1-(9H-xanthene-9-carbonyl)piperidine-3-carboxylate
Chemical Structure Depiction of
ethyl 1-(9H-xanthene-9-carbonyl)piperidine-3-carboxylate
ethyl 1-(9H-xanthene-9-carbonyl)piperidine-3-carboxylate
Compound characteristics
| Compound ID: | 4100-3897 |
| Compound Name: | ethyl 1-(9H-xanthene-9-carbonyl)piperidine-3-carboxylate |
| Molecular Weight: | 365.43 |
| Molecular Formula: | C22 H23 N O4 |
| Smiles: | CCOC(C1CCCN(C1)C(C1c2ccccc2Oc2ccccc12)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.4122 |
| logD: | -2.3613 |
| logSw: | -3.6546 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 44.387 |
| InChI Key: | JENKHIFRXUYYFD-HNNXBMFYSA-N |