N-methyl-2-(4-{[4-(4-methylphenyl)phthalazin-1-yl]amino}phenoxy)acetamide
Chemical Structure Depiction of
N-methyl-2-(4-{[4-(4-methylphenyl)phthalazin-1-yl]amino}phenoxy)acetamide
N-methyl-2-(4-{[4-(4-methylphenyl)phthalazin-1-yl]amino}phenoxy)acetamide
Compound characteristics
| Compound ID: | 4109-2004 |
| Compound Name: | N-methyl-2-(4-{[4-(4-methylphenyl)phthalazin-1-yl]amino}phenoxy)acetamide |
| Molecular Weight: | 398.46 |
| Molecular Formula: | C24 H22 N4 O2 |
| Smiles: | Cc1ccc(cc1)c1c2ccccc2c(Nc2ccc(cc2)OCC(NC)=O)nn1 |
| Stereo: | ACHIRAL |
| logP: | 3.8853 |
| logD: | 3.8847 |
| logSw: | -3.9802 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 63.882 |
| InChI Key: | DCNJBEFVSGVYJI-UHFFFAOYSA-N |