2-(2-methoxyanilino)-N'-[1-(thiophen-2-yl)ethylidene]acetohydrazide
Chemical Structure Depiction of
2-(2-methoxyanilino)-N'-[1-(thiophen-2-yl)ethylidene]acetohydrazide
2-(2-methoxyanilino)-N'-[1-(thiophen-2-yl)ethylidene]acetohydrazide
Compound characteristics
| Compound ID: | 4111-1625 |
| Compound Name: | 2-(2-methoxyanilino)-N'-[1-(thiophen-2-yl)ethylidene]acetohydrazide |
| Molecular Weight: | 303.38 |
| Molecular Formula: | C15 H17 N3 O2 S |
| Smiles: | C\C(c1cccs1)=N/NC(CNc1ccccc1OC)=O |
| Stereo: | ACHIRAL |
| logP: | 3.1626 |
| logD: | 3.1621 |
| logSw: | -3.333 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 53.086 |
| InChI Key: | DLZRZLZHFFNELP-UHFFFAOYSA-N |