2-(2-methoxyanilino)-N'-[1-(thiophen-2-yl)ethylidene]acetohydrazide
					Chemical Structure Depiction of
2-(2-methoxyanilino)-N'-[1-(thiophen-2-yl)ethylidene]acetohydrazide
			2-(2-methoxyanilino)-N'-[1-(thiophen-2-yl)ethylidene]acetohydrazide
Compound characteristics
| Compound ID: | 4111-1625 | 
| Compound Name: | 2-(2-methoxyanilino)-N'-[1-(thiophen-2-yl)ethylidene]acetohydrazide | 
| Molecular Weight: | 303.38 | 
| Molecular Formula: | C15 H17 N3 O2 S | 
| Smiles: | C\C(c1cccs1)=N/NC(CNc1ccccc1OC)=O | 
| Stereo: | ACHIRAL | 
| logP: | 3.1626 | 
| logD: | 3.1621 | 
| logSw: | -3.333 | 
| Hydrogen bond acceptors count: | 4 | 
| Hydrogen bond donors count: | 2 | 
| Polar surface area: | 53.086 | 
| InChI Key: | DLZRZLZHFFNELP-UHFFFAOYSA-N | 
 
				 
				