dimethyl 5-[2-(3,4-dimethoxyphenyl)acetamido]-3-methylthiophene-2,4-dicarboxylate
Chemical Structure Depiction of
dimethyl 5-[2-(3,4-dimethoxyphenyl)acetamido]-3-methylthiophene-2,4-dicarboxylate
dimethyl 5-[2-(3,4-dimethoxyphenyl)acetamido]-3-methylthiophene-2,4-dicarboxylate
Compound characteristics
| Compound ID: | 4112-0402 |
| Compound Name: | dimethyl 5-[2-(3,4-dimethoxyphenyl)acetamido]-3-methylthiophene-2,4-dicarboxylate |
| Molecular Weight: | 407.44 |
| Molecular Formula: | C19 H21 N O7 S |
| Smiles: | Cc1c(C(=O)OC)c(NC(Cc2ccc(c(c2)OC)OC)=O)sc1C(=O)OC |
| Stereo: | ACHIRAL |
| logP: | 2.2861 |
| logD: | -0.2855 |
| logSw: | -2.9514 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 80.519 |
| InChI Key: | YMBHSDDBMVPBOG-UHFFFAOYSA-N |