4-{[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino}-N-(2,6-dimethoxypyrimidin-4-yl)benzene-1-sulfonamide
Chemical Structure Depiction of
4-{[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino}-N-(2,6-dimethoxypyrimidin-4-yl)benzene-1-sulfonamide
4-{[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino}-N-(2,6-dimethoxypyrimidin-4-yl)benzene-1-sulfonamide
Compound characteristics
| Compound ID: | 4112-3731 |
| Compound Name: | 4-{[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino}-N-(2,6-dimethoxypyrimidin-4-yl)benzene-1-sulfonamide |
| Molecular Weight: | 548.44 |
| Molecular Formula: | C21 H18 Br N5 O4 S2 |
| Smiles: | COc1cc(NS(c2ccc(cc2)Nc2nc(cs2)c2ccc(cc2)[Br])(=O)=O)nc(n1)OC |
| Stereo: | ACHIRAL |
| logP: | 6.1073 |
| logD: | 2.9797 |
| logSw: | -5.6903 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 93.503 |
| InChI Key: | MNUUGDGTIXCBIP-UHFFFAOYSA-N |