1-{1-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dimethyl-1H-pyrrol-3-yl}-2-(4-methylpiperidin-1-yl)ethan-1-one
Chemical Structure Depiction of
1-{1-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dimethyl-1H-pyrrol-3-yl}-2-(4-methylpiperidin-1-yl)ethan-1-one
1-{1-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dimethyl-1H-pyrrol-3-yl}-2-(4-methylpiperidin-1-yl)ethan-1-one
Compound characteristics
| Compound ID: | 4112-3778 |
| Compound Name: | 1-{1-[4-chloro-3-(trifluoromethyl)phenyl]-2,5-dimethyl-1H-pyrrol-3-yl}-2-(4-methylpiperidin-1-yl)ethan-1-one |
| Molecular Weight: | 412.88 |
| Molecular Formula: | C21 H24 Cl F3 N2 O |
| Smiles: | CC1CCN(CC1)CC(c1cc(C)n(c2ccc(c(c2)C(F)(F)F)[Cl])c1C)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9375 |
| logD: | 3.717 |
| logSw: | -4.9786 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 19.8828 |
| InChI Key: | WQQYNMWVLPWGKY-UHFFFAOYSA-N |