5-(4-ethoxyphenyl)-7,8-dimethoxy-1-methyl-3-phenyl-3H-pyrazolo[3,4-c]isoquinoline
Chemical Structure Depiction of
5-(4-ethoxyphenyl)-7,8-dimethoxy-1-methyl-3-phenyl-3H-pyrazolo[3,4-c]isoquinoline
5-(4-ethoxyphenyl)-7,8-dimethoxy-1-methyl-3-phenyl-3H-pyrazolo[3,4-c]isoquinoline
Compound characteristics
| Compound ID: | 4116-0099 |
| Compound Name: | 5-(4-ethoxyphenyl)-7,8-dimethoxy-1-methyl-3-phenyl-3H-pyrazolo[3,4-c]isoquinoline |
| Molecular Weight: | 439.51 |
| Molecular Formula: | C27 H25 N3 O3 |
| Smiles: | CCOc1ccc(cc1)c1c2cc(c(cc2c2c(C)nn(c3ccccc3)c2n1)OC)OC |
| Stereo: | ACHIRAL |
| logP: | 5.3256 |
| logD: | 5.3153 |
| logSw: | -5.6963 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 46.246 |
| InChI Key: | SMZNYKDZIMNKJH-UHFFFAOYSA-N |