N-[3-(cyclopentyloxy)-4-methoxyphenyl]-1-(3-phenylpropyl)piperidine-3-carboxamide--but-2-enedioic acid (1/1)
Chemical Structure Depiction of
N-[3-(cyclopentyloxy)-4-methoxyphenyl]-1-(3-phenylpropyl)piperidine-3-carboxamide--but-2-enedioic acid (1/1)
N-[3-(cyclopentyloxy)-4-methoxyphenyl]-1-(3-phenylpropyl)piperidine-3-carboxamide--but-2-enedioic acid (1/1)
Compound characteristics
| Compound ID: | 4120-0459 |
| Compound Name: | N-[3-(cyclopentyloxy)-4-methoxyphenyl]-1-(3-phenylpropyl)piperidine-3-carboxamide--but-2-enedioic acid (1/1) |
| Molecular Weight: | 552.67 |
| Molecular Formula: | C27 H36 N2 O3 |
| Salt: | HOOCCH=CHCOOH |
| Smiles: | COc1ccc(cc1OC1CCCC1)NC(C1CCCN(CCCc2ccccc2)C1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.7575 |
| logD: | 3.8985 |
| logSw: | -4.4866 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.511 |
| InChI Key: | PALBNMBVMCQMAC-QFIPXVFZSA-N |