N-(2,4-dimethoxyphenyl)-2-phenylquinoline-4-carboxamide
Chemical Structure Depiction of
N-(2,4-dimethoxyphenyl)-2-phenylquinoline-4-carboxamide
N-(2,4-dimethoxyphenyl)-2-phenylquinoline-4-carboxamide
Compound characteristics
| Compound ID: | 4130-5181 |
| Compound Name: | N-(2,4-dimethoxyphenyl)-2-phenylquinoline-4-carboxamide |
| Molecular Weight: | 384.43 |
| Molecular Formula: | C24 H20 N2 O3 |
| Smiles: | COc1ccc(c(c1)OC)NC(c1cc(c2ccccc2)nc2ccccc12)=O |
| Stereo: | ACHIRAL |
| logP: | 5.3938 |
| logD: | 5.3937 |
| logSw: | -5.8133 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.865 |
| InChI Key: | ZCCUPOACSYTFRT-UHFFFAOYSA-N |