(1H-benzimidazol-1-yl)(5-chloro-2-methoxyphenyl)methanone
Chemical Structure Depiction of
(1H-benzimidazol-1-yl)(5-chloro-2-methoxyphenyl)methanone
(1H-benzimidazol-1-yl)(5-chloro-2-methoxyphenyl)methanone
Compound characteristics
| Compound ID: | 4130-6146 |
| Compound Name: | (1H-benzimidazol-1-yl)(5-chloro-2-methoxyphenyl)methanone |
| Molecular Weight: | 286.72 |
| Molecular Formula: | C15 H11 Cl N2 O2 |
| Smiles: | COc1ccc(cc1C(n1cnc2ccccc12)=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 2.9462 |
| logD: | 2.9462 |
| logSw: | -3.3608 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 31.709 |
| InChI Key: | GOANEJUYIDYXTL-UHFFFAOYSA-N |