N-(3-benzamidophenyl)-5-(4-bromophenyl)furan-2-carboxamide
Chemical Structure Depiction of
N-(3-benzamidophenyl)-5-(4-bromophenyl)furan-2-carboxamide
N-(3-benzamidophenyl)-5-(4-bromophenyl)furan-2-carboxamide
Compound characteristics
| Compound ID: | 4137-1357 |
| Compound Name: | N-(3-benzamidophenyl)-5-(4-bromophenyl)furan-2-carboxamide |
| Molecular Weight: | 461.31 |
| Molecular Formula: | C24 H17 Br N2 O3 |
| Smiles: | c1ccc(cc1)C(Nc1cccc(c1)NC(c1ccc(c2ccc(cc2)[Br])o1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.8785 |
| logD: | 5.8784 |
| logSw: | -6.1718 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 54.82 |
| InChI Key: | IRZJZUGHPKIWPO-UHFFFAOYSA-N |