tert-butyl [(4-butyl-8-methyl-2-oxo-2H-1-benzopyran-7-yl)oxy]acetate
Chemical Structure Depiction of
tert-butyl [(4-butyl-8-methyl-2-oxo-2H-1-benzopyran-7-yl)oxy]acetate
tert-butyl [(4-butyl-8-methyl-2-oxo-2H-1-benzopyran-7-yl)oxy]acetate
Compound characteristics
| Compound ID: | 4182-0091 |
| Compound Name: | tert-butyl [(4-butyl-8-methyl-2-oxo-2H-1-benzopyran-7-yl)oxy]acetate |
| Molecular Weight: | 346.42 |
| Molecular Formula: | C20 H26 O5 |
| Smiles: | CCCCC1=CC(=O)Oc2c1ccc(c2C)OCC(=O)OC(C)(C)C |
| Stereo: | ACHIRAL |
| logP: | 4.7013 |
| logD: | 4.7013 |
| logSw: | -4.6218 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 47.184 |
| InChI Key: | UGHBMXYSBYCYRK-UHFFFAOYSA-N |