methyl 2-[(3-benzyl-4,8-dimethyl-2-oxo-2H-1-benzopyran-7-yl)oxy]propanoate
Chemical Structure Depiction of
methyl 2-[(3-benzyl-4,8-dimethyl-2-oxo-2H-1-benzopyran-7-yl)oxy]propanoate
methyl 2-[(3-benzyl-4,8-dimethyl-2-oxo-2H-1-benzopyran-7-yl)oxy]propanoate
Compound characteristics
| Compound ID: | 4182-0251 |
| Compound Name: | methyl 2-[(3-benzyl-4,8-dimethyl-2-oxo-2H-1-benzopyran-7-yl)oxy]propanoate |
| Molecular Weight: | 366.41 |
| Molecular Formula: | C22 H22 O5 |
| Smiles: | CC(C(=O)OC)Oc1ccc2C(C)=C(Cc3ccccc3)C(=O)Oc2c1C |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.5795 |
| logD: | 4.5795 |
| logSw: | -4.7132 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 48.622 |
| InChI Key: | LZEABGIBVNDQJL-HNNXBMFYSA-N |