6-chloro-4-ethyl-7-[(2-fluorophenyl)methoxy]-2H-1-benzopyran-2-one
Chemical Structure Depiction of
6-chloro-4-ethyl-7-[(2-fluorophenyl)methoxy]-2H-1-benzopyran-2-one
6-chloro-4-ethyl-7-[(2-fluorophenyl)methoxy]-2H-1-benzopyran-2-one
Compound characteristics
| Compound ID: | 4182-0442 |
| Compound Name: | 6-chloro-4-ethyl-7-[(2-fluorophenyl)methoxy]-2H-1-benzopyran-2-one |
| Molecular Weight: | 332.76 |
| Molecular Formula: | C18 H14 Cl F O3 |
| Smiles: | CCC1=CC(=O)Oc2cc(c(cc12)[Cl])OCc1ccccc1F |
| Stereo: | ACHIRAL |
| logP: | 4.9739 |
| logD: | 4.9739 |
| logSw: | -5.1185 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 27.9599 |
| InChI Key: | CUUNIRXJIKNQDG-UHFFFAOYSA-N |