6'-methyl-2'-(methylsulfanyl)-2H-[1,4'-bipyrimidine]-2,4(3H)-dione
Chemical Structure Depiction of
6'-methyl-2'-(methylsulfanyl)-2H-[1,4'-bipyrimidine]-2,4(3H)-dione
6'-methyl-2'-(methylsulfanyl)-2H-[1,4'-bipyrimidine]-2,4(3H)-dione
Compound characteristics
| Compound ID: | 4209-0064 |
| Compound Name: | 6'-methyl-2'-(methylsulfanyl)-2H-[1,4'-bipyrimidine]-2,4(3H)-dione |
| Molecular Weight: | 250.28 |
| Molecular Formula: | C10 H10 N4 O2 S |
| Smiles: | Cc1cc(nc(n1)SC)N1C=CC(NC1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.195 |
| logD: | 1.1941 |
| logSw: | -2.2341 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.89 |
| InChI Key: | JIPJBTDXKJPUEH-UHFFFAOYSA-N |