ethyl 5-[(2,5-dimethylphenyl)carbamoyl]-2-(2-fluorobenzamido)-4-methylthiophene-3-carboxylate
Chemical Structure Depiction of
ethyl 5-[(2,5-dimethylphenyl)carbamoyl]-2-(2-fluorobenzamido)-4-methylthiophene-3-carboxylate
ethyl 5-[(2,5-dimethylphenyl)carbamoyl]-2-(2-fluorobenzamido)-4-methylthiophene-3-carboxylate
Compound characteristics
| Compound ID: | 4223-6941 |
| Compound Name: | ethyl 5-[(2,5-dimethylphenyl)carbamoyl]-2-(2-fluorobenzamido)-4-methylthiophene-3-carboxylate |
| Molecular Weight: | 454.52 |
| Molecular Formula: | C24 H23 F N2 O4 S |
| Smiles: | CCOC(c1c(C)c(C(Nc2cc(C)ccc2C)=O)sc1NC(c1ccccc1F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.472 |
| logD: | -0.8686 |
| logSw: | -4.3744 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 66.271 |
| InChI Key: | BQCQYBXEXAMAKN-UHFFFAOYSA-N |