3-{[5-(4-chlorophenyl)-2-oxofuran-3(2H)-ylidene]methyl}phenyl acetate
Chemical Structure Depiction of
3-{[5-(4-chlorophenyl)-2-oxofuran-3(2H)-ylidene]methyl}phenyl acetate
3-{[5-(4-chlorophenyl)-2-oxofuran-3(2H)-ylidene]methyl}phenyl acetate
Compound characteristics
| Compound ID: | 4228-1488 |
| Compound Name: | 3-{[5-(4-chlorophenyl)-2-oxofuran-3(2H)-ylidene]methyl}phenyl acetate |
| Molecular Weight: | 340.76 |
| Molecular Formula: | C19 H13 Cl O4 |
| Smiles: | CC(=O)Oc1cccc(\C=C2/C=C(c3ccc(cc3)[Cl])OC2=O)c1 |
| Stereo: | ACHIRAL |
| logP: | 4.1216 |
| logD: | 4.1216 |
| logSw: | -4.6449 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 43.491 |
| InChI Key: | ZGXLAEWCZIRLDM-UHFFFAOYSA-N |