4-(4-chlorophenyl)-1-(4-methoxyphenyl)-1,3-dihydro-2H-imidazole-2-thione
Chemical Structure Depiction of
4-(4-chlorophenyl)-1-(4-methoxyphenyl)-1,3-dihydro-2H-imidazole-2-thione
4-(4-chlorophenyl)-1-(4-methoxyphenyl)-1,3-dihydro-2H-imidazole-2-thione
Compound characteristics
| Compound ID: | 4236-3416 |
| Compound Name: | 4-(4-chlorophenyl)-1-(4-methoxyphenyl)-1,3-dihydro-2H-imidazole-2-thione |
| Molecular Weight: | 316.81 |
| Molecular Formula: | C16 H13 Cl N2 O S |
| Smiles: | COc1ccc(cc1)N1C=C(c2ccc(cc2)[Cl])NC1=S |
| Stereo: | ACHIRAL |
| logP: | 4.1126 |
| logD: | 1.5398 |
| logSw: | -4.6397 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 21.942 |
| InChI Key: | IKRSEZLYYLQKIU-UHFFFAOYSA-N |