methyl 2-({3-methoxy-4-[(thiophene-2-carbonyl)oxy]phenyl}methylidene)hydrazine-1-carboxylate
Chemical Structure Depiction of
methyl 2-({3-methoxy-4-[(thiophene-2-carbonyl)oxy]phenyl}methylidene)hydrazine-1-carboxylate
methyl 2-({3-methoxy-4-[(thiophene-2-carbonyl)oxy]phenyl}methylidene)hydrazine-1-carboxylate
Compound characteristics
| Compound ID: | 4241-4990 |
| Compound Name: | methyl 2-({3-methoxy-4-[(thiophene-2-carbonyl)oxy]phenyl}methylidene)hydrazine-1-carboxylate |
| Molecular Weight: | 334.35 |
| Molecular Formula: | C15 H14 N2 O5 S |
| Smiles: | COC(N/N=C\c1ccc(c(c1)OC)OC(c1cccs1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9334 |
| logD: | 2.931 |
| logSw: | -3.455 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 73.44 |
| InChI Key: | DIFHUONUGZIWHR-UHFFFAOYSA-N |