3-(2-chlorophenyl)-4-oxo-4H-1-benzopyran-7-yl 3,4-dimethoxybenzoate
Chemical Structure Depiction of
3-(2-chlorophenyl)-4-oxo-4H-1-benzopyran-7-yl 3,4-dimethoxybenzoate
3-(2-chlorophenyl)-4-oxo-4H-1-benzopyran-7-yl 3,4-dimethoxybenzoate
Compound characteristics
| Compound ID: | 4248-0299 |
| Compound Name: | 3-(2-chlorophenyl)-4-oxo-4H-1-benzopyran-7-yl 3,4-dimethoxybenzoate |
| Molecular Weight: | 436.85 |
| Molecular Formula: | C24 H17 Cl O6 |
| Smiles: | COc1ccc(cc1OC)C(=O)Oc1ccc2C(C(=COc2c1)c1ccccc1[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 4.1255 |
| logD: | 4.1255 |
| logSw: | -4.5544 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 56.499 |
| InChI Key: | AADGYBYPLUNFBM-UHFFFAOYSA-N |