ethyl (2-methylindolizin-3-yl)(oxo)acetate
Chemical Structure Depiction of
ethyl (2-methylindolizin-3-yl)(oxo)acetate
ethyl (2-methylindolizin-3-yl)(oxo)acetate
Compound characteristics
| Compound ID: | 4257-1668 |
| Compound Name: | ethyl (2-methylindolizin-3-yl)(oxo)acetate |
| Molecular Weight: | 231.25 |
| Molecular Formula: | C13 H13 N O3 |
| Smiles: | CCOC(C(c1c(C)cc2ccccn12)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5573 |
| logD: | 2.5572 |
| logSw: | -2.5878 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 33.413 |
| InChI Key: | JOTRBOXKCFHVLY-UHFFFAOYSA-N |