8-(benzylamino)-1,3,7-trimethyl-3,7-dihydro-1H-purine-2,6-dione
Chemical Structure Depiction of
8-(benzylamino)-1,3,7-trimethyl-3,7-dihydro-1H-purine-2,6-dione
8-(benzylamino)-1,3,7-trimethyl-3,7-dihydro-1H-purine-2,6-dione
Compound characteristics
| Compound ID: | 4265-2314 |
| Compound Name: | 8-(benzylamino)-1,3,7-trimethyl-3,7-dihydro-1H-purine-2,6-dione |
| Molecular Weight: | 299.33 |
| Molecular Formula: | C15 H17 N5 O2 |
| Smiles: | CN1C(c2c(nc(NCc3ccccc3)n2C)N(C)C1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.7861 |
| logD: | 1.7828 |
| logSw: | -1.9475 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.928 |
| InChI Key: | LBVXMQUYMRVXIJ-UHFFFAOYSA-N |