N~1~-(5-butyl-1,3,4-thiadiazol-2-yl)-2-cyano-3-{4-[2-(3-ethyl-5-methylphenoxy)ethoxy]-3-methoxyphenyl}acrylamide
Chemical Structure Depiction of
N~1~-(5-butyl-1,3,4-thiadiazol-2-yl)-2-cyano-3-{4-[2-(3-ethyl-5-methylphenoxy)ethoxy]-3-methoxyphenyl}acrylamide
N~1~-(5-butyl-1,3,4-thiadiazol-2-yl)-2-cyano-3-{4-[2-(3-ethyl-5-methylphenoxy)ethoxy]-3-methoxyphenyl}acrylamide
Compound characteristics
| Compound ID: | 4272-0318 |
| Compound Name: | N~1~-(5-butyl-1,3,4-thiadiazol-2-yl)-2-cyano-3-{4-[2-(3-ethyl-5-methylphenoxy)ethoxy]-3-methoxyphenyl}acrylamide |
| Molecular Weight: | 520.65 |
| Molecular Formula: | C28 H32 N4 O4 S |
| Smiles: | CCCCc1nnc(NC(C(=C/c2ccc(c(c2)OC)OCCOc2cc(C)cc(CC)c2)\C#N)=O)s1 |
| Stereo: | ACHIRAL |
| logP: | 6.88 |
| logD: | 4.95 |
| logSw: | -7.16 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 177.6 |
| InChI Key: | GKVXQQIRHLGFRT-UHFFFAOYSA-N |