N~1~-(5-butyl-1,3,4-thiadiazol-2-yl)-3-{3-chloro-5-methoxy-4-[2-(3-methylphenoxy)ethoxy]phenyl}-2-cyanoacrylamide
Chemical Structure Depiction of
N~1~-(5-butyl-1,3,4-thiadiazol-2-yl)-3-{3-chloro-5-methoxy-4-[2-(3-methylphenoxy)ethoxy]phenyl}-2-cyanoacrylamide
N~1~-(5-butyl-1,3,4-thiadiazol-2-yl)-3-{3-chloro-5-methoxy-4-[2-(3-methylphenoxy)ethoxy]phenyl}-2-cyanoacrylamide
Compound characteristics
| Compound ID: | 4272-0362 |
| Compound Name: | N~1~-(5-butyl-1,3,4-thiadiazol-2-yl)-3-{3-chloro-5-methoxy-4-[2-(3-methylphenoxy)ethoxy]phenyl}-2-cyanoacrylamide |
| Molecular Weight: | 527.04 |
| Molecular Formula: | C26 H27 Cl N4 O4 S |
| Smiles: | CCCCc1nnc(NC(C(=C/c2cc(c(c(c2)[Cl])OCCOc2cccc(C)c2)OC)\C#N)=O)s1 |
| Stereo: | ACHIRAL |
| logP: | 6.74 |
| logD: | 4.81 |
| logSw: | -7.42 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 160.46 |
| InChI Key: | QYKBUDOUJZPBCU-UHFFFAOYSA-N |