N-[4-(diethylsulfamoyl)phenyl]-3,4,5-trimethoxybenzamide
Chemical Structure Depiction of
N-[4-(diethylsulfamoyl)phenyl]-3,4,5-trimethoxybenzamide
N-[4-(diethylsulfamoyl)phenyl]-3,4,5-trimethoxybenzamide
Compound characteristics
| Compound ID: | 4275-0523 |
| Compound Name: | N-[4-(diethylsulfamoyl)phenyl]-3,4,5-trimethoxybenzamide |
| Molecular Weight: | 422.5 |
| Molecular Formula: | C20 H26 N2 O6 S |
| Smiles: | CCN(CC)S(c1ccc(cc1)NC(c1cc(c(c(c1)OC)OC)OC)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.7259 |
| logD: | 2.7254 |
| logSw: | -3.4557 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 77.404 |
| InChI Key: | DYDSUEYDKULUSZ-UHFFFAOYSA-N |