1-(2,6-dichlorophenyl)-3-[(dimethylamino)methylidene]-5-nitro-1,3-dihydro-2H-indol-2-one
Chemical Structure Depiction of
1-(2,6-dichlorophenyl)-3-[(dimethylamino)methylidene]-5-nitro-1,3-dihydro-2H-indol-2-one
1-(2,6-dichlorophenyl)-3-[(dimethylamino)methylidene]-5-nitro-1,3-dihydro-2H-indol-2-one
Compound characteristics
| Compound ID: | 4286-0215 |
| Compound Name: | 1-(2,6-dichlorophenyl)-3-[(dimethylamino)methylidene]-5-nitro-1,3-dihydro-2H-indol-2-one |
| Molecular Weight: | 378.21 |
| Molecular Formula: | C17 H13 Cl2 N3 O3 |
| Smiles: | CN(C)/C=C1C(N(c2ccc(cc/12)[N+]([O-])=O)c1c(cccc1[Cl])[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 3.3187 |
| logD: | 3.3187 |
| logSw: | -3.7212 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 52.373 |
| InChI Key: | UGKRSBQRMLTIRT-XFXZXTDPSA-N |