2-{[3-cyano-6-oxo-4-(thiophen-2-yl)-1,4,5,6-tetrahydropyridin-2-yl]sulfanyl}-N-(1,3-thiazol-2-yl)acetamide
Chemical Structure Depiction of
2-{[3-cyano-6-oxo-4-(thiophen-2-yl)-1,4,5,6-tetrahydropyridin-2-yl]sulfanyl}-N-(1,3-thiazol-2-yl)acetamide
2-{[3-cyano-6-oxo-4-(thiophen-2-yl)-1,4,5,6-tetrahydropyridin-2-yl]sulfanyl}-N-(1,3-thiazol-2-yl)acetamide
Compound characteristics
| Compound ID: | 4296-0192 |
| Compound Name: | 2-{[3-cyano-6-oxo-4-(thiophen-2-yl)-1,4,5,6-tetrahydropyridin-2-yl]sulfanyl}-N-(1,3-thiazol-2-yl)acetamide |
| Molecular Weight: | 376.48 |
| Molecular Formula: | C15 H12 N4 O2 S3 |
| Smiles: | C1C(C(C#N)=C(NC1=O)SCC(Nc1nccs1)=O)c1cccs1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.7658 |
| logD: | 1.7081 |
| logSw: | -2.4313 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 75.562 |
| InChI Key: | SIRXBAZURPNBER-VIFPVBQESA-N |