6-{[2-(3-chloro-4-methylanilino)-2-oxoethyl]sulfanyl}-N-(4-chlorophenyl)-5-cyano-2-methyl-1,4-dihydro[4,4'-bipyridine]-3-carboxamide
Chemical Structure Depiction of
6-{[2-(3-chloro-4-methylanilino)-2-oxoethyl]sulfanyl}-N-(4-chlorophenyl)-5-cyano-2-methyl-1,4-dihydro[4,4'-bipyridine]-3-carboxamide
6-{[2-(3-chloro-4-methylanilino)-2-oxoethyl]sulfanyl}-N-(4-chlorophenyl)-5-cyano-2-methyl-1,4-dihydro[4,4'-bipyridine]-3-carboxamide
Compound characteristics
| Compound ID: | 4296-0872 |
| Compound Name: | 6-{[2-(3-chloro-4-methylanilino)-2-oxoethyl]sulfanyl}-N-(4-chlorophenyl)-5-cyano-2-methyl-1,4-dihydro[4,4'-bipyridine]-3-carboxamide |
| Molecular Weight: | 564.49 |
| Molecular Formula: | C28 H23 Cl2 N5 O2 S |
| Smiles: | CC1=C(C(C(C#N)=C(N1)SCC(Nc1ccc(C)c(c1)[Cl])=O)c1ccncc1)C(Nc1ccc(cc1)[Cl])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.7425 |
| logD: | 5.0283 |
| logSw: | -6.0751 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 82.499 |
| InChI Key: | QUBHLYPIRFXZKG-SANMLTNESA-N |