4-bromo-2-[2-(quinolin-2-yl)ethenyl]phenol
Chemical Structure Depiction of
4-bromo-2-[2-(quinolin-2-yl)ethenyl]phenol
4-bromo-2-[2-(quinolin-2-yl)ethenyl]phenol
Compound characteristics
| Compound ID: | 4298-0228 |
| Compound Name: | 4-bromo-2-[2-(quinolin-2-yl)ethenyl]phenol |
| Molecular Weight: | 326.19 |
| Molecular Formula: | C17 H12 Br N O |
| Smiles: | C(=C/c1ccc2ccccc2n1)\c1cc(ccc1O)[Br] |
| Stereo: | ACHIRAL |
| logP: | 4.9669 |
| logD: | 4.9016 |
| logSw: | -5.1551 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 25.341 |
| InChI Key: | NDJYIQKCWCPIPP-UHFFFAOYSA-N |