5-[(2-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-3-phenyl-1,3-thiazolidine-2,4-dione
Chemical Structure Depiction of
5-[(2-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-3-phenyl-1,3-thiazolidine-2,4-dione
5-[(2-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-3-phenyl-1,3-thiazolidine-2,4-dione
Compound characteristics
| Compound ID: | 4299-0788 |
| Compound Name: | 5-[(2-bromo-5-ethoxy-4-hydroxyphenyl)methylidene]-3-phenyl-1,3-thiazolidine-2,4-dione |
| Molecular Weight: | 420.28 |
| Molecular Formula: | C18 H14 Br N O4 S |
| Smiles: | CCOc1cc(/C=C2/C(N(C(=O)S2)c2ccccc2)=O)c(cc1O)[Br] |
| Stereo: | ACHIRAL |
| logP: | 4.0797 |
| logD: | 4.0645 |
| logSw: | -3.8273 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.742 |
| InChI Key: | WRJALMRGGKMBAL-UHFFFAOYSA-N |