methyl {2,6-dichloro-4-[(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]phenoxy}acetate
Chemical Structure Depiction of
methyl {2,6-dichloro-4-[(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]phenoxy}acetate
methyl {2,6-dichloro-4-[(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]phenoxy}acetate
Compound characteristics
| Compound ID: | 4299-0790 |
| Compound Name: | methyl {2,6-dichloro-4-[(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]phenoxy}acetate |
| Molecular Weight: | 438.28 |
| Molecular Formula: | C19 H13 Cl2 N O5 S |
| Smiles: | COC(COc1c(cc(/C=C2/C(N(C(=O)S2)c2ccccc2)=O)cc1[Cl])[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 4.5538 |
| logD: | 4.5538 |
| logSw: | -4.6262 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 57.235 |
| InChI Key: | GQHPXRGKEGBAKT-UHFFFAOYSA-N |