{4-[3-(3,5-dimethyl-1H-pyrazol-1-yl)-4-nitrophenyl]piperazin-1-yl}(4-methylphenyl)methanone
Chemical Structure Depiction of
{4-[3-(3,5-dimethyl-1H-pyrazol-1-yl)-4-nitrophenyl]piperazin-1-yl}(4-methylphenyl)methanone
{4-[3-(3,5-dimethyl-1H-pyrazol-1-yl)-4-nitrophenyl]piperazin-1-yl}(4-methylphenyl)methanone
Compound characteristics
| Compound ID: | 4299-1928 |
| Compound Name: | {4-[3-(3,5-dimethyl-1H-pyrazol-1-yl)-4-nitrophenyl]piperazin-1-yl}(4-methylphenyl)methanone |
| Molecular Weight: | 419.48 |
| Molecular Formula: | C23 H25 N5 O3 |
| Smiles: | Cc1ccc(cc1)C(N1CCN(CC1)c1ccc(c(c1)n1c(C)cc(C)n1)[N+]([O-])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0921 |
| logD: | 3.0921 |
| logSw: | -3.3036 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 66.798 |
| InChI Key: | AVEANYYBJDJHKI-UHFFFAOYSA-N |