ethyl 2-(4-methoxyanilino)-5-[(3-methoxyphenyl)methylidene]-4-oxo-4,5-dihydrothiophene-3-carboxylate
Chemical Structure Depiction of
ethyl 2-(4-methoxyanilino)-5-[(3-methoxyphenyl)methylidene]-4-oxo-4,5-dihydrothiophene-3-carboxylate
ethyl 2-(4-methoxyanilino)-5-[(3-methoxyphenyl)methylidene]-4-oxo-4,5-dihydrothiophene-3-carboxylate
Compound characteristics
| Compound ID: | 4302-2355 |
| Compound Name: | ethyl 2-(4-methoxyanilino)-5-[(3-methoxyphenyl)methylidene]-4-oxo-4,5-dihydrothiophene-3-carboxylate |
| Molecular Weight: | 411.48 |
| Molecular Formula: | C22 H21 N O5 S |
| Smiles: | CCOC(C1=C(Nc2ccc(cc2)OC)SC(=C/c2cccc(c2)OC)\C1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.921 |
| logD: | 4.897 |
| logSw: | -4.6474 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.205 |
| InChI Key: | GZUFAKKOWJGSBU-UHFFFAOYSA-N |