ethyl 5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-2-(4-methoxyanilino)-4-oxo-4,5-dihydrothiophene-3-carboxylate
					Chemical Structure Depiction of
ethyl 5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-2-(4-methoxyanilino)-4-oxo-4,5-dihydrothiophene-3-carboxylate
			ethyl 5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-2-(4-methoxyanilino)-4-oxo-4,5-dihydrothiophene-3-carboxylate
Compound characteristics
| Compound ID: | 4302-2368 | 
| Compound Name: | ethyl 5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-2-(4-methoxyanilino)-4-oxo-4,5-dihydrothiophene-3-carboxylate | 
| Molecular Weight: | 457.5 | 
| Molecular Formula: | C23 H23 N O7 S | 
| Smiles: | CCOC(C1=C(Nc2ccc(cc2)OC)SC(=C/c2cc(c(c(c2)OC)O)OC)\C1=O)=O | 
| Stereo: | ACHIRAL | 
| logP: | 4.0173 | 
| logD: | 3.9933 | 
| logSw: | -4.1002 | 
| Hydrogen bond acceptors count: | 10 | 
| Hydrogen bond donors count: | 2 | 
| Polar surface area: | 80.401 | 
| InChI Key: | JZBMBKNHMQGWKG-UHFFFAOYSA-N | 
 
				 
				