ethyl 4-[5-ethyl-2-(ethylsulfanyl)thiophen-3-yl]-2-methyl-5-oxo-7-phenyl-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate
Chemical Structure Depiction of
ethyl 4-[5-ethyl-2-(ethylsulfanyl)thiophen-3-yl]-2-methyl-5-oxo-7-phenyl-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate
ethyl 4-[5-ethyl-2-(ethylsulfanyl)thiophen-3-yl]-2-methyl-5-oxo-7-phenyl-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate
Compound characteristics
| Compound ID: | 4306-0640 |
| Compound Name: | ethyl 4-[5-ethyl-2-(ethylsulfanyl)thiophen-3-yl]-2-methyl-5-oxo-7-phenyl-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate |
| Molecular Weight: | 481.68 |
| Molecular Formula: | C27 H31 N O3 S2 |
| Smiles: | CCc1cc(C2C(=C(C)NC3CC(CC(C2=3)=O)c2ccccc2)C(=O)OCC)c(SCC)s1 |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 7.0988 |
| logD: | 2.5777 |
| logSw: | -5.6122 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.422 |
| InChI Key: | DTPOVUMPZQHSJW-UHFFFAOYSA-N |