2-{[2-(3-methoxyphenoxy)ethyl]sulfanyl}quinazolin-4(1H)-one
Chemical Structure Depiction of
2-{[2-(3-methoxyphenoxy)ethyl]sulfanyl}quinazolin-4(1H)-one
2-{[2-(3-methoxyphenoxy)ethyl]sulfanyl}quinazolin-4(1H)-one
Compound characteristics
| Compound ID: | 4327-3250 |
| Compound Name: | 2-{[2-(3-methoxyphenoxy)ethyl]sulfanyl}quinazolin-4(1H)-one |
| Molecular Weight: | 328.39 |
| Molecular Formula: | C17 H16 N2 O3 S |
| Smiles: | COc1cccc(c1)OCCSC1Nc2ccccc2C(N=1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3412 |
| logD: | 2.9323 |
| logSw: | -3.7582 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.463 |
| InChI Key: | NOQZPPSTWIWRGU-UHFFFAOYSA-N |