2-{[2-(4-ethoxyphenoxy)ethyl]sulfanyl}-6-methylpyrimidin-4(1H)-one
Chemical Structure Depiction of
2-{[2-(4-ethoxyphenoxy)ethyl]sulfanyl}-6-methylpyrimidin-4(1H)-one
2-{[2-(4-ethoxyphenoxy)ethyl]sulfanyl}-6-methylpyrimidin-4(1H)-one
Compound characteristics
| Compound ID: | 4327-3328 |
| Compound Name: | 2-{[2-(4-ethoxyphenoxy)ethyl]sulfanyl}-6-methylpyrimidin-4(1H)-one |
| Molecular Weight: | 306.38 |
| Molecular Formula: | C15 H18 N2 O3 S |
| Smiles: | CCOc1ccc(cc1)OCCSC1NC(C)=CC(N=1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.4073 |
| logD: | 0.1581 |
| logSw: | -2.7874 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.841 |
| InChI Key: | LUAHPDNZYCFEPV-UHFFFAOYSA-N |