4-(3-bromophenyl)-N-(2-chlorophenyl)-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxamide
Chemical Structure Depiction of
4-(3-bromophenyl)-N-(2-chlorophenyl)-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxamide
4-(3-bromophenyl)-N-(2-chlorophenyl)-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxamide
Compound characteristics
| Compound ID: | 4339-0746 |
| Compound Name: | 4-(3-bromophenyl)-N-(2-chlorophenyl)-6-methyl-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxamide |
| Molecular Weight: | 420.69 |
| Molecular Formula: | C18 H15 Br Cl N3 O2 |
| Smiles: | CC1=C(C(c2cccc(c2)[Br])NC(N1)=O)C(Nc1ccccc1[Cl])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.4096 |
| logD: | 3.3143 |
| logSw: | -3.596 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 58.085 |
| InChI Key: | YMXHRRUCEREPMQ-INIZCTEOSA-N |