4-(4-chlorobenzoyl)-5-(2-fluorophenyl)-3-hydroxy-1-[3-(morpholin-4-yl)propyl]-1,5-dihydro-2H-pyrrol-2-one
Chemical Structure Depiction of
4-(4-chlorobenzoyl)-5-(2-fluorophenyl)-3-hydroxy-1-[3-(morpholin-4-yl)propyl]-1,5-dihydro-2H-pyrrol-2-one
4-(4-chlorobenzoyl)-5-(2-fluorophenyl)-3-hydroxy-1-[3-(morpholin-4-yl)propyl]-1,5-dihydro-2H-pyrrol-2-one
Compound characteristics
| Compound ID: | 4340-0449 |
| Compound Name: | 4-(4-chlorobenzoyl)-5-(2-fluorophenyl)-3-hydroxy-1-[3-(morpholin-4-yl)propyl]-1,5-dihydro-2H-pyrrol-2-one |
| Molecular Weight: | 458.92 |
| Molecular Formula: | C24 H24 Cl F N2 O4 |
| Smiles: | C(CN1CCOCC1)CN1C(C(=C(C1=O)O)C(c1ccc(cc1)[Cl])=O)c1ccccc1F |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.2285 |
| logD: | 3.0539 |
| logSw: | -3.7189 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.696 |
| InChI Key: | GOYUGWUNMJRYJK-OAQYLSRUSA-N |