4-butoxy-N-{4-[(pyrimidin-2-yl)sulfamoyl]phenyl}benzamide
Chemical Structure Depiction of
4-butoxy-N-{4-[(pyrimidin-2-yl)sulfamoyl]phenyl}benzamide
4-butoxy-N-{4-[(pyrimidin-2-yl)sulfamoyl]phenyl}benzamide
Compound characteristics
| Compound ID: | 4341-0959 |
| Compound Name: | 4-butoxy-N-{4-[(pyrimidin-2-yl)sulfamoyl]phenyl}benzamide |
| Molecular Weight: | 426.49 |
| Molecular Formula: | C21 H22 N4 O4 S |
| Smiles: | CCCCOc1ccc(cc1)C(Nc1ccc(cc1)S(Nc1ncccn1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.1576 |
| logD: | 2.4023 |
| logSw: | -3.5927 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 91.966 |
| InChI Key: | YWTUWLBTPRFDJD-UHFFFAOYSA-N |