2-[(4-butoxy-3-methoxyphenyl)methylidene]-6-phenyl-7H-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7(2H)-dione
Chemical Structure Depiction of
2-[(4-butoxy-3-methoxyphenyl)methylidene]-6-phenyl-7H-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7(2H)-dione
2-[(4-butoxy-3-methoxyphenyl)methylidene]-6-phenyl-7H-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7(2H)-dione
Compound characteristics
| Compound ID: | 4341-3368 |
| Compound Name: | 2-[(4-butoxy-3-methoxyphenyl)methylidene]-6-phenyl-7H-[1,3]thiazolo[3,2-b][1,2,4]triazine-3,7(2H)-dione |
| Molecular Weight: | 435.5 |
| Molecular Formula: | C23 H21 N3 O4 S |
| Smiles: | CCCCOc1ccc(/C=C2/C(N3C(=NC(C(c4ccccc4)=N3)=O)S2)=O)cc1OC |
| Stereo: | ACHIRAL |
| logP: | 4.0727 |
| logD: | 4.0727 |
| logSw: | -4.0917 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 65.783 |
| InChI Key: | NTUBEWDNTCKJHD-UHFFFAOYSA-N |