3-carbamoyl-2-phenyl-1-benzofuran-5-yl acetate
Chemical Structure Depiction of
3-carbamoyl-2-phenyl-1-benzofuran-5-yl acetate
3-carbamoyl-2-phenyl-1-benzofuran-5-yl acetate
Compound characteristics
| Compound ID: | 4356-0269 |
| Compound Name: | 3-carbamoyl-2-phenyl-1-benzofuran-5-yl acetate |
| Molecular Weight: | 295.29 |
| Molecular Formula: | C17 H13 N O4 |
| Smiles: | CC(=O)Oc1ccc2c(c1)c(C(N)=O)c(c1ccccc1)o2 |
| Stereo: | ACHIRAL |
| logP: | 1.886 |
| logD: | 1.886 |
| logSw: | -2.3549 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 63.303 |
| InChI Key: | XQJWKSUZYCZAKM-UHFFFAOYSA-N |