2-methoxyethyl 2-methyl-5-[(thiophene-2-carbonyl)oxy]-1-benzofuran-3-carboxylate
Chemical Structure Depiction of
2-methoxyethyl 2-methyl-5-[(thiophene-2-carbonyl)oxy]-1-benzofuran-3-carboxylate
2-methoxyethyl 2-methyl-5-[(thiophene-2-carbonyl)oxy]-1-benzofuran-3-carboxylate
Compound characteristics
| Compound ID: | 4356-0598 |
| Compound Name: | 2-methoxyethyl 2-methyl-5-[(thiophene-2-carbonyl)oxy]-1-benzofuran-3-carboxylate |
| Molecular Weight: | 360.38 |
| Molecular Formula: | C18 H16 O6 S |
| Smiles: | Cc1c(C(=O)OCCOC)c2cc(ccc2o1)OC(c1cccs1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0921 |
| logD: | 3.0921 |
| logSw: | -3.2106 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 58.972 |
| InChI Key: | XOMDPCJPFXWCAJ-UHFFFAOYSA-N |