ethyl 6-chloro-8-methyl-4-(2-methylanilino)quinoline-3-carboxylate
Chemical Structure Depiction of
ethyl 6-chloro-8-methyl-4-(2-methylanilino)quinoline-3-carboxylate
ethyl 6-chloro-8-methyl-4-(2-methylanilino)quinoline-3-carboxylate
Compound characteristics
| Compound ID: | 4358-1383 |
| Compound Name: | ethyl 6-chloro-8-methyl-4-(2-methylanilino)quinoline-3-carboxylate |
| Molecular Weight: | 354.83 |
| Molecular Formula: | C20 H19 Cl N2 O2 |
| Smiles: | CCOC(c1cnc2c(C)cc(cc2c1Nc1ccccc1C)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 5.7393 |
| logD: | 5.7392 |
| logSw: | -5.8772 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 37.434 |
| InChI Key: | YYKQINFZARYTEW-UHFFFAOYSA-N |