4-(4-tert-butylphenoxy)-N-[5-(propan-2-yl)-1,3,4-thiadiazol-2-yl]butanamide
Chemical Structure Depiction of
4-(4-tert-butylphenoxy)-N-[5-(propan-2-yl)-1,3,4-thiadiazol-2-yl]butanamide
4-(4-tert-butylphenoxy)-N-[5-(propan-2-yl)-1,3,4-thiadiazol-2-yl]butanamide
Compound characteristics
| Compound ID: | 4358-3075 |
| Compound Name: | 4-(4-tert-butylphenoxy)-N-[5-(propan-2-yl)-1,3,4-thiadiazol-2-yl]butanamide |
| Molecular Weight: | 361.5 |
| Molecular Formula: | C19 H27 N3 O2 S |
| Smiles: | CC(C)c1nnc(NC(CCCOc2ccc(cc2)C(C)(C)C)=O)s1 |
| Stereo: | ACHIRAL |
| logP: | 5.0655 |
| logD: | 4.9834 |
| logSw: | -4.4878 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.079 |
| InChI Key: | YOLQFRQPZNWTHU-UHFFFAOYSA-N |