ethyl 2-[4-(4-chlorophenoxy)butanamido]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate
Chemical Structure Depiction of
ethyl 2-[4-(4-chlorophenoxy)butanamido]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate
ethyl 2-[4-(4-chlorophenoxy)butanamido]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate
Compound characteristics
| Compound ID: | 4358-3181 |
| Compound Name: | ethyl 2-[4-(4-chlorophenoxy)butanamido]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| Molecular Weight: | 407.91 |
| Molecular Formula: | C20 H22 Cl N O4 S |
| Smiles: | CCOC(c1c2CCCc2sc1NC(CCCOc1ccc(cc1)[Cl])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5684 |
| logD: | 2.2241 |
| logSw: | -4.891 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.369 |
| InChI Key: | QEMPPFQEHLLDLV-UHFFFAOYSA-N |